Answer:
0.0253 M/s
Explanation:
From the reaction
N₂ + 3H₂ → 2NH₃
The rate of reaction can be written as
Rate = - ![\frac{d[N_2]}{dt}](https://tex.z-dn.net/?f=%5Cfrac%7Bd%5BN_2%5D%7D%7Bdt%7D)
= - ![\frac{1}{3} \frac{d[H_2]}{dt}](https://tex.z-dn.net/?f=%5Cfrac%7B1%7D%7B3%7D%20%5Cfrac%7Bd%5BH_2%5D%7D%7Bdt%7D)
= + ![\frac{1}{2} \frac{d[NH_3]}{dt}](https://tex.z-dn.net/?f=%5Cfrac%7B1%7D%7B2%7D%20%5Cfrac%7Bd%5BNH_3%5D%7D%7Bdt%7D)
From the above rate equation we can conclude that the rate of reaction of N₂ is equal to one third of the rate of reaction of H₂,
So,
Rate of reaction of molecular nitrogen = 
Upon calculation, we get rate of reaction of molecular nitrogen = 0.0253 M/s
Answer:
The molecular formula is C12H18O3
Explanation:
Step 1: Data given
The empirical formula is C4H6O
Molecular weight is 212 g/mol
atomic mass of C = 12 g/mol
atomic mass of H = 1 g/mol
atomic mass of O = 16 g/mol
Step 2: Calculate the molar mass of the empirical formula
Molar mass = 4* 12 + 6*1 +16
Molar mass = 70 g/mol
Step 3: Calculate the molecular formula
We have to multiply the empirical formula by n
n = the molecular weight of the empirical formula / the molecular weight of the molecular formula
n = 70 /212 ≈ 3
We have to multiply the empirical formula by 3
3*(C4H6O- = C12H18O3
The molecular formula is C12H18O3
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
The logarithm from my understanding can never be negative. You can check this on a calculator. You may have a negative if it is shown as -(log x).
