D.) There must be an equal number of atoms of each element on both sides of the equation
Answer:
Evaporation
Explanation:
Heat makes molecules move and eventually evaporate.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Q = m c T
c= 0.140 j/(g x °c)
m= 250.0g
T =52
hope you can solve it now
@pandamille help her please!!!!
