It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
The final pressure of the carbon dioxide gas will 11.84 atm.
Explanation:
Moles of carbonic acid =
According to reaction, 1 mol of carbonic acid gives 1 mole of carbon dioxide gas.
Then 0.9677 moles of carbonic acid will give :
of carbon dioxide
Moles of carbon dioxide gas = n = 0.09677 mol
Volume of soda bottle =
Pressure of the carbon dioxide gas = P
Temperature of the carbon dioxide gas = T = 298 K
(ideal gas law)
The final pressure of the carbon dioxide gas will 11.84 atm.
The limiting factor is food. Even if there is room for 100 more, there isn't food to sustain more than 400 birds at a given time.
Answer:Others such as producers, consumers, herbivores, carnivores, omnivores, and decomposers
Explanation:
B.
When electricians get their license, they are only licensed to install parallel circuits. Most electricians aren't certified to install series circuits.