Answer:
87.9%
Explanation:
Balanced Chemical Equation:
HCl + NaOH = NaCl + H2O
We are Given:
Mass of H2O = 9.17 g
Mass of HCl = 21.1 g
Mass of NaOH = 43.6 g
First, calculate the moles of both HCl and NaOH:
Moles of HCl: 21.1 g of HCl x 1 mole of HCl/36.46 g of HCl = 0.579 moles
Moles of NaOH: 43.6 g of NaOH x 1 mole of NaOH/40.00 g of NaOH = 1.09 moles
Here you calculate the mole of H2O from the moles of both HCl and NaOH using the balanced chemical equation:
Moles of H2O from the moles of HCl: 0.579 moles of HCl x 1 mole of H2O/1 mole of HCl = 0.579 moles
Moles of H2O from the moles of NaOH: 1.09 moles of HCl x 1 mole of H2O/1 mole of NaOH = 1.09 moles
From the calculations above, we can see that the limiting reagent is HCl because it produced the lower amount of moles of H2O. Therefore, we use 0.579 moles and NOT 1.09 moles to calculate the mass of H2O:
Mass of H2O: 0.579 moles of H2O x 18.02 g of H2O/1 mole of H2O = 10.43 g
% yield of H2O = actual yield/theoretical yield x 100= 9.17 g/10.43 g x 100 = 87.9%
The answer is boiling liquids I think
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Boyle’s Law P1V1 = P2V2
P1 = 0.80 atm V1 = 1.8 L
P2 = 1.0 atm V2 = ??
(.8 atm)(1.8 L) = (1.0 atm)(V2)
1.44 atm x L = 1 atm V2
Answer:
Electrons are in "orbitals", regions of space where there is high probability of being found.
Explanation:
The Wave mechanical model of the atom does not restrict the electrons to certain energy levels only as in the Bohr's model, instead it describes a region around the nucleus called an orbital, where there is a high probability of finding an electron with a certain amount of energy.
Each energy level is composed of one or more orbitals and the distribution of electrons around the nucleus is determined by the number and kind of energy levels that are occupied.
