TNT has the molecular formula: C7H5N3O6. And hence, when reacted in oxygen gas, you get what is known as <span>combustion</span> reaction. the reaction is: <span><span>C7</span><span>H5</span><span>N3</span><span>O6</span>+<span>O2</span>→C<span>O2</span>+<span>N2</span>+<span>H2</span><span>O</span></span>
Answer:
"Anion" is correct option
Explanation:
An anion is an ion that has gained one or more electrons, acquiring a negative charge.
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
