Fluorine is a nonmetal and as such it would need to take in or obtain an electron from a metal to have a stable octet, or full number of 8 electrons in its valence shell. Thus due to the indifference of electrons and protons it becomes an anion, a negatively charged ion.
<span>The "exosphere" is the most distant and tenuous "layer" of our atmosphere.</span>
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Forces are pushes and pulls that may change the motion of an object. Balanced forces result in an object remaining at rest or moving at a constant speed. Unbalanced forces result in the acceleration of an object. An object's motion depends on how it changes position.
Answer:
............................................