Answer:
A decrease in the total volume of the reaction vessel (T constant)
Explanation:
- Le Châtelier's principle predicts that the moles of H2 in the reaction container will increase with a decrease in the total volume of the reaction vessel.
- <em><u>According to the Le Chatelier's principle, when a chnage is a applied to a system at equilibrium, then the equilibrium will shift in a way that counteracts the effect causing it.</u></em>
- In this case, a decrease in volume means there is an increase in pressure, therefore the equilibrium will shift towards the side with the fewer number of moles of gas.
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Answer:
313, 6grams of H3PO4
Explanation:
We calculate the weight of 1 mol of H3PO4:
Weight 1 mol H3PO4= (Weight H)x3+ (Weight P)+(Weight 0)x4 =1gx3+31g+16gx4
Weight 1 mol H3PO4=98 g /mol
1 mol-----98 grams H3PO4
3,2mol----x= (3,2molx 98 grams H3PO4)/ 1mol=313,6 grams H3PO4
