In humans, height, skin color, hair color, and eye color are examples of polygenic traits.
A polygene is a member of a collection of non-epistatic genes that interact additively to steer a phenotypic trait, consequently contributing to more than one-gene inheritance, a sort of non-Mendelian inheritance, in preference to unmarried-gene inheritance, which is the core belief of Mendelian inheritance.
A polygenic trait is a feature, which includes height or skin coloration, that is encouraged by way of or extra genes. because a couple of genes are concerned, polygenic developments do not comply with the styles of Mendelian inheritance. Many polygenic traits are also stimulated by means of the environment and are called multifactorial.
Most inherited trends in animals are polygenic. a few examples are: conformation, kind, size, sturdiness, disorder resistance, temperament, velocity, milk and egg production, growth fee, maturation and sexual adulthood rate, and numerous inherited diseases.
Learn more about polygenic traits here:-brainly.com/question/27493732
#SPJ4
Answer:
Oxides are chemical compounds with one or more oxygen atoms combined with another element (e.g. Li2O). Oxides are binary compounds of oxygen with another element, e.g., CO2, SO2, CaO, CO, ZnO, BaO2, H2O, etc. These are termed as oxides because here, oxygen is in combination with only one element.
Explanation:
C because
Explanation Plato
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Melt chocolate and measure the temperature and then melt wax and measure the temperature and compare his results.
