boyles law states that the volumes of a gas will decrease as pressure increases if the temperature remains constant.
charles law states that the volume of a gas will increase as temp increases if the pressure remains constant.
gay-lussacs law states that the pressure increases as temp increases if the volume remains constant.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
I think that the trend that would be seen in the time column of the data table would be that the number of seconds would increase. I know this because for each flask, the concentration of sodium thiosulfate decreases, since less of it is being mixed with more water. Also, when the concentration of a substance decreases, then the reaction rate also decreases, as there will be fewer collisions with sulfuric acid if there are fewer moles of sodium thiosulfate. When there are fewer collisions in a reaction, the reaction itself will take longer, and so when the sodium thiosulfate is diluted, the reaction takes more time.
Explanation:
<em>I verify this is correct. </em>
Molar mass Na2CO3 = 106 g/mole
Using dimensional analysis:
0.787 moles Na2CO3 x 106 g/mole Na2CO3 = g Na2CO3
Answer = 83.4 g Na2CO3
A because magma is underground
