I think the answer would be : Tetrahedral
Oxygen has 6 electrons and need 2 more electron to complete its octet. In Tetrahedral, the electrons are arranged so it surround the oxygen and forming a 109 degree bond angel/
hope this helps
The answer is mechanical wave!
Hope this helps!
Brainliest and a like is much appreciated!
Answer:
0.677 moles
Explanation:
Take the atomic mass of K = 39.1, O =16.0, P = 31.0
no. of moles = mass / molar mass
no. of moles of K3PO4 used = 4.79 / (39.1x3 + 31 + 16x4)
= 0.02256 mol
From the equation, the mole ratio of KOH : K3PO4 = 3 :1,
meaning every 3 moles of KOH used, produces 1 mole of K3PO4.
So, using this ratio, let the no. of moles of KOH required to be y.

y = 0.02256 x3
y = 0.0677 mol
If you don't find exactly 0.677 moles as one of the options, go for the closest one. A very slight error may occur because of taking different significant figures of atomic masses when calculating.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer : The mole fraction of NaCl in a mixture is, 0.360
Explanation : Given,
Moles of
= 7.21 mole
Moles of
= 9.37 mole
Moles of
= 3.42 mole
Now we have to calculate the mole fraction of
.

Now put all the given values in this formula, we get:

Therefore, the mole fraction of NaCl in a mixture is, 0.360