Answer:
1.204428 * 10^24 atoms
Explanation:
Number of moles = 2 mol
Number of atoms = ?
The relationship between moles and atoms is given by the avogadro's umber. This is the number of units in one mole of a substance. The units can be atoms, ions etc In this case it is atoms. The number is equal to 6.02214076 * 10^23
This means;
1 mol = 6.02214076 * 10^23
2 mol = x
Upon solving for x,
x = 2 * 6.02214076 * 10^23
x = 12.04428 * 10^23
x = 1.204428 * 10^24 atoms
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
It should have 10 electrons
1.3622052x10^6 you move the . 6 places to the left making it a positive 10^6
