The given example is a chemical reaction.
The contents (separated as reactants and products) :

The written reaction is :

<em>I hope it helped you solve the problem.</em>
<em>Good luck on your studies!</em>
The last one 1) exothermic; 2) exothermic
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
The number of C atoms in 0.524 moles of C is 3.15 atoms.
The number of
molecules in 9.87 moles
is 59.43 molecules.
The moles of Fe in 1.40 x
atoms of Fe is 0.23 x 
The moles of
in 2.30x
molecules of
is 3.81.
<h3>What are moles?</h3>
A mole is defined as 6.02214076 ×
of some chemical unit, be it atoms, molecules, ions, or others. The mole is a convenient unit to use because of the great number of atoms, molecules, or others in any substance.
A. The number of C atoms in 0.524 mole of C:
6.02214076 ×
x 0.524 mole
3.155601758 atoms =3.155 atoms
B. The number of
molecules in 9.87 moles of
:
6.02214076 ×
x 9.87
59.4385293 molecules= 59.43 molecules
C. The moles of Fe in 1.40 x
atoms of Fe:
1.40 x
÷ 6.02214076 × 
0.2324754694 x
moles.
0.23 x
moles.
D. The moles of
in 2.30x
molecules of
:
2.30x
÷ 6.02214076 × 
3.819239854 moles=3.81 moles
Learn more about moles here:
brainly.com/question/8455949
#SPJ1