Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
Answer:
its b nasa and every other space obsessed place has done all of that
Environmental conditions
Explanation:
Traits that are due to environmental conditions are considered to be acquired traits. This kind of trait are not coded in the DNA and passed down as inherited traits.
- A larger body muscle due to regular exercise and fitness training is an acquired trait.
- Skin color most times are inherited.
- Acquired traits are typically conditioned due to the environment an organism finds itself.
- These traits cannot be passed down.
Learn more:
Traits brainly.com/question/2908634
#learnwithBrainly
Answer:
Find the steps and explanation below.
Explanation:
A. Kids make slime following these basic steps;
1. In a bowl, is 1/4 cup of water is added to 1 oz. of glue. Add coloring if you wish to.
2. 1/4 cup of Borax solution, also known as Sodium Tetraborate is added to the mixture and gradually stirred.
3. The mixture is kneaded with the hands to ensure a smooth consistency.
4. Water remnants are discarded and the slime is stored in a plastic bag and kept in the fridge.
B.
What each ingredient does
Polyvinyl acetate present in the glue acts as a liquid polymer.
Borax binds the liquid polymers together.
Water eases the mixing process
C.
If lesser ingredients are used, the slime will not have its characteristic slimy nature. If excess of the ingredients are used, the slime becomes very sticky.
