hi these are the answers :)
Moles of lead(Pb) = 1.6x10^23/6.02x10^23 = 0.265 moles.
Weight of lead = moles x atomic weight of lead
= 0.265x207.2
= 54.908 grams.
Hope this helps!
Answer:
4 lead = Pb
2 nitrogen = N
6 oxygen = O
Explanation:
Know the rules of multiplying wth perentheses.
- Hope that helped! Please let me know if you need further explanation.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Trueeeeeeeeeeeeeeeee!!!!!
