The highest atom economy
2CO + O₂ ⇒ 2CO₂
<h3>Further explanation</h3>
Given
The reaction for the production of CO₂
Required
The highest atom economy
Solution
In reactions, there are sometimes unwanted products that can be said to be a by-product or a waste product. Meanwhile, the desired product can be said to be a useful product, which can be shown as the atom economy
of the reaction
the higher the atomic economy value of a reaction, the smaller the waste/ byproducts produced, so that less energy is wasted
The general formula:
Atom economy = (mass of useful product : mass of all reactants/products) x 100
<em>or
</em>
Atom economy = (total formula masses of useful product : total formula masses of all reactants/products) x 100
So a reaction that only produces one product will have the highest atomic value, namely the reaction in option C
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Reactivity could be one also toxicity flammability ect
