Answer:
Two tectonic plates had the same density and a collision of the plates pushed the advancing plate that contained fossilized marine organisms upward forming the Himalayan mountains and Mount Everest.
Electrical energy is the energy of electrons
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
A molecular size affects the rate of evaporation when the larger the intermolecular forces in a compound, the slower the evaporation rate and this correlates with temperature change.
Molecular size seems to have an effect on evaporation rates in that the larger a molecule gets or grows from a base chemical formula, its evaporation rate will get slower.
<h3>What is the molecular size?</h3>
This is a measure of the area a molecule occupies in three-dimensional space as this relates to the physical size of an individual molecule.
Hence, we can see that a molecular size affects the rate of evaporation the larger the forces, the lower the rate.
Read more about<em> molecular size</em> here:
brainly.com/question/16616599
#SPJ1
