CBr4 is a symmetric tetrahedral molecule so it will be non-polar.
Answer:
B. it is a community of plants,animals and there physical surrounding.
Answer:
the endangered spices act
Explanation: The US Endangered Species Act (ESA) is our nation's most effective law to protect at-risk species from extinction, with a stellar success rate: 99% of species listed on it have avoided extinction.
Proton and neutron, which are both approximately 1 amu
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane