It is mostly used in applications that need measuring substances that would have a<span> relatively neutral pH . </span>A<span> common use is for measuring the presence of carbonic </span>acid<span> in </span>a<span> liquid. so yes its acidic</span>
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
On adding salt.....The boiling temperature increases.....
So ∆t= KB * molality
=O.52*(58/58)/4
= O.52*1/4
= 0.13
So increase is 100+.13=100.13°c
Answer:
For deposition to happen, thermal energy must be removed from the gas. ... As water vapor loses thermal energy, it changes into solid frost. States of Water. Water is the only substance that exists naturally as a solid, a liquid, and a gas within Earth's temperature range.
Explanation:
Answer:
The Flow rate = 0.0208 mL/min
Explanation:
Data provided:
Rate of dose = 39 mg every 30 min = (39/30) mg/min = 1.3 mg/min
also,
125mg of methylprednisolone is present in every 2 mL
thus,
concentration = (125/2) mg/mL = 62.5 mg/mL
Now,
The flow rate is given as:
Flow rate = Rate / Concentration
on substituting the respective values, we get
Flow rate = (1.3 mg/min) / (62.5mg/mL)
or
The Flow rate = 0.0208 mL/min