Let us assume that there is a 100g sample present. The respective mass of each element will then be:
C: 74 g
H: 7.4 g
N: 8.6 g
O: 10 g
Now, we divide each constituent's mass by its Mr to obtain the moles of each
C: (74 / 12) = 6.17
H: (7.4 / 1) = 7.4
N: (8.6 / 14) = 0.61
O: (10 / 16) = 0.625
Dividing by the smallest number:
C: 10
H: 12
N: 1
O: 1
Thus, the empirical formula is
C10H12NO
Answer:
1.1 percent
Explanation:
C6H5COOH⇌C6H5COO+H
Ka = [C6H5COO-][H+]/[C6H5COOH]
From pKa of 4.2, Ka = 6.3x10^-5
6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...
6.3x10^-5 = x^2/0.51
x^2 = 3.213x10^-5
x =5.67 x10^-3
(5.67x10^-3/0.51)x 100 =1.1 percent
<span>The question says.'which option describes a similarity between isotopes of an element. The correct option is C. Isotopes have the same number of atomic number but different mass number. The mass number is the summation of proton and neutron. The number of proton is always constant but that of neutron changes to reflect the existence of isotopes.</span>
Well uncontrolled cell division can lead to cancer.