All categories

3 years ago

BRAINLIEST AWARD!! Why is potassium nitrate a solute in a .3M potassium nitrate solution? Please explain:D

Chemistry

1 answer:

Bond [772]3 years ago

8 0

Answer:

In a .3M KNO3 solution, the KNO3 is dissolved in water. Water is the solvent and KNO3 is the solute, because the solute is what is dissolved. Also, all potassium compounds and nitrate compounds are soluble, so you know that KNO3 dissociates into K+ and NO3- in water.

You might be interested in

_____ is the most abundant gas in th Earths atmosphere?

ollegr [7]

The answer to the question would be B since Nitrogen is the most abundant gas in our atmosphere

5 0

3 years ago

Read 2 more answers

Below is a list of terms used in characterizing solutions. Enter the correct term for each sentence. Note that not all of the te

AlladinOne [14]

Answer:

molality, mole fraction, solvent, solute, molarity.

Explanation:

The expression of concentration that provides the moles of solute per kilograms of solvent is molality.

$b=\frac{n_{solute}}{m_{solvent}(kg)}$

If you place 5 moles of sodium chloride and 4 moles of sucrose into 11 moles of water, the mole fraction of sodium chloride would be 0.25

$X(NaCl)=\frac{molesNaCl}{moles_{solution}} =\frac{5mol}{20mol} =0.25$

A solution is made up of 0.15 grams of sodium chloride in 1 liter of water. For this solution, the solvent is water.

The solvent is the component in major proportion and the one that defines the state of the solution.

A solution is made up of 0.15 grams of sodium chloride in 1 liter of water. For this solution, the solute is sodium chloride.

The solute is the component in minor proportion.

A way to express concentration that provides the moles of solute per liter of solution is molarity.

$M=\frac{n_{solute}}{V_{solution}(L)}$

3 0

3 years ago

Benzoic acid is a weak acid that has antimicrobial properties. Its sodium salt, sodium benzoate, is a preservative found in food

Ksju [112]

Answer:

1.1 percent

Explanation:

C6H5COOH⇌C6H5COO+H

Ka = [C6H5COO-][H+]/[C6H5COOH]

From pKa of 4.2, Ka = 6.3x10^-5

6.3x10^-5 = (x)(x)/0.51-x and assuming x is small...

6.3x10^-5 = x^2/0.51

x^2 = 3.213x10^-5

x =5.67 x10^-3

(5.67x10^-3/0.51)x 100 =1.1 percent

3 0

3 years ago

How do I solve this?

ira [324]

Sorry, I can't really see the question )-:

6 0

4 years ago

Sonni added 23.79 mL of KOH to 20.00 mL of 0.393 M HF until the equivalence point was reached. What is the concentration of conj

madreJ [45]

Answer:

0.1795 M

Explanation:

From the given information:

The equation is:

$\mathbf{HF_{(aq)}+ KOH_{(aq)} \to KF _{(aq)} + H_2O}$

From the above equation, the reaction will go to completion due to the strong base:

At the equivalence point, moles of acid (HF) will be equal to moles of base (KOH)

$\text{Number of moles = Volume} \times Molarity$

Thus. since moles of HF = moles of KOH

Then; 0.020 × 0.393 M = 0.02379 × (x) M

(x) M = $\dfrac{0.02 \times 0.393 \ M}{0.02379}$

(x) = 0.3304 M

Thus, the molarity of KOH = 0.3304 M

Using the balanced neutralization reaction;

moles of HF = moles of KOH = moles of conjugate base = 0.00786 mol

∴

Volume = 0.020 L + 0.02379 L

Volume = 0.04379 L

Volume of the solution = 0.04379 L

Therefore; Molarity = $\dfrac{moles}{volume}$

Molarity = $\dfrac{0.00786 \ mol}{0.04379 \ L}$

Molarity = 0.17949 mol/L

= 0.1795 M

7 0

3 years ago