The answer is B. I just took the quiz and got it right. Hope it's the same thing for you.
Each period in the periodic table corresponds to a principal energy level
Superfluidity is the characteristic property of a fluid with zero viscosity which therefore flows without loss of kinetic energy. An example of a superfluid would be liquid helium.
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
