Depression of a freezing point of the solutions depends on the number of particles of the solute in the solution.
1 mol of C6H12O6 after dissolving in water still be 1 mol, because C6H12O6 does no dissociate in water.
1 mol of C2H5OH after dissolving in water still be 1 mol, because C2H5OH does no dissociate in water.
1 mol of NaCl after dissolving in water gives 2 mol of particles (ions), because NaCl is a strong electrolyte(as salt) and completely dissociates in water.
NaCl ----->Na⁺ + Cl⁻
1 mol of CH3COOH after dissolving in water gives more than 1 mol but less than 2 moles, because CH3COOH is a weak electrolyte (weak acid) and dissociates only partially.
So, most particles of the solute is going to be in the solution of NaCl,
so<span> the lowest freezing point has the aqueous solution of NaCl.</span>
Answer:
-12.3 degrees F.
Originally Answered: At what temperature does the Kelvin scale read double the Fahrenheit reading? -24.6 degrees C = -12.3 degrees F.
Explanation:
Li2O is the formula for <span> lithium oxide</span>
<span>Petroleum and biomass are burned in combustion reactions, which liberate energy stored in chemical bonds. This is chemical energy. In contrast, nuclear energy comes from the conversion of mass into energy when an nuclear reaction occurs. Geothermal energy comes directly from heat sources underground, with no chemical or nuclear reactions.</span>
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
