Answer: the boiling point elevation constant is 
Explanation:
Elevation in boiling point is given by:
= Elevation in boling point
i= vant hoff factor = 1 (for non electrolyte)
=boiling point constant = ?
m= molality
Weight of solvent (diethylether)= 330 g = 0.33 kg
Molar mass of solute (benzophenone)= 182 g/mol
Mass of solute (benzophenone) = 38.2 g
Thus the boiling point elevation constant is
Hello!
My argument: Which is better a Ps4 or an Xbox 1
The Ps4 is a better all-round console. The PS4 costs $100 less but has less games than the Xbox 1. The Xbox 1 now came up with dual compatible games. This means that certain games can now run on the Xbox 1 and the Xbox 360. The overall winner is really undetermined. The controller for Xbox has more quicker response time and is specifically built to be an extremely comfortable in your hands. Unlike the PS4 which their controller is built for nothing they really didn't do anything to theirs. Although the console comparisons are the same. The hard drive for the Xbox is non- removable meaning that if you want the hard drive. you would have to break the Xbox to get it . Unlike the Ps4 when you can take it out easily and switch it with any console and still have your data. I am an Xbox fan since for ever but I think that the two consoles are built the same.
Hope it helps!
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
No elements visible!
Ions form between metals and non-metals.
Hope this helps!
1000 g of feathers is the least dense
