Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
<em>ANSWER - 6 MOLES OF </em><em>IRON</em>
Fe2O3(s) + 3H2(g) → 2Fe(s) + 3H2O(1)
One moles of Fe2O3 forming 2 moles of Fe
3 moles of Fe2O3 will form 2×3 = 6 moles of iron
you could easily search this on Google but it's 0.004312.
1000000 Cubic Meter is 1 cubic centimeter.
but if there is 4312, do 4312/10000000..
If all the particles in a material are made up of
several smaller particles, and every larger particle
is identical, is the material a pure substance or
not? Explain your reasoning.
A pure substance is something like a compound and element. This material made of several particles which seem to be two different particles, I believe, is a mixture. So, it is not a pure substance mixtures are made up of more than one particle while compounds (In a fixed ratio, the fusion of two or more than two atoms) and elements are made up of one molecule essentially.
