Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer:
The smallest particle of a chemical element can be defined as an atom.
Explanation:
The number of protons in one atom of an element determines the atom's identity, and the number of electrons determines its electrical charge.
a single electron or one of two or more electrons in the outer shell of an atom that is responsible for the chemical properties of the atom is known as valence electrons.
An atom's reactivity is its tendency to lose or gain electrons. ... This is because they have one outer electron and losing it gives them the stability of a outer electron shell as the next level... The reactivities of elements can be predicted by periodic trends.
Answer is: (4) emits energy as it moves to a lower energy state.
Atom emits a characteristic set of discrete wavelengths, according to its electronic energy levels.
Emission spectrum of a chemical element is the spectrum of frequencies emitted due to an atom making a transition from a high energy state to a lower energy state.
Each transition has a specific energy difference.
Each element's emission spectrum is unique.
Answer:
B the atmosphere it's not on earth and I'm pretty sure the atmosphere doesn't have water in
Explanation:
Answer:
kp= 3.1 x 10^(-2)
Explanation:
To solve this problem we have to write down the reaction and use the ICE table for pressures:
2SO2 + O2 ⇄ 2SO3
Initial 3.4 atm 1.3 atm 0 atm
Change -2x - x + 2x
Equilibrium 3.4 - 2x 1.3 -x 0.52 atm
In order to know the x value:
2x = 0.52
x=(0.52)/2= 0.26
2SO2 + O2 ⇄ 2SO3
Equilibrium 3.4 - 0.52 1.3 - 0.26 0.52 atm
Equilibrium 2.88 atm 1.04 atm 0.52 atm
with the partial pressure in the equilibrium, we can obtain Kp.
