Answer:
24.525 g of sulfuric acid.
Explanation:
Hello,
Normality (units of eq/L) is defined as:
Since the sulfuric acid is the solute, and we already have the volume of the solution (500 mL) but we need it in liters (0.5 L, just divide into 1000), the equivalent grams of solute are given by:
Now, since the sulfuric acid is diprotic (2 hydrogen atoms in its formula) 1 mole of sulfuric acid has 2 equivalent grams of sulfuric acid, so the mole-mass relationship is developed to find its required mass as follows:
Best regards.
Human bone does not contain oxygen
The specific gravity or relative density of a substance is the ratio of its density to the density of a reference material. The relative density of the concentrated salt solution is 1.044.
Mathematically;
Density of the concentrated salt = mass of salt/volume of salt = 5.222 g/5.000 mL = 1.044 g/mL
In the case of specific gravity, the reference material is always water and water has a density of 1 g/mL.
Hence, specific gravity of the concentrated salt solution =
Density of concentrated salt solution/density of equal volume of water
= 1.044 g/mL/1 g/mL
= 1.044
Note that specific gravity is dimensionless.
Learn more: brainly.com/question/9638888
Answer:
The empirical formula is the simplest form;
Given:
Oxygen O at 94.1% and
H at 5.9%
Assume 100grams.
94% = 0.941 x 100gm. = 94.1 gm x 1mole/16gm. = 5.88 moles of O
5.9% = 0.059 x 100gm. = 5.9gm. X 1moleH/1.002gm. = 5.88 moles of H
There is one mole of O for each mole of H so the empirical formula is 
and written as OH.
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
