The mass of a substance per unit volume is the substance's density.
D = m/v.
Answer:
What are large, relatively flat areas? ... Why are coastal plains also called lowlands? ... What is a grassy wetland usually flooded with water? ... What rises steeply from the land around them? ... flat raised landform made up of nearly horizontal rocks that have been uplifted ... distances in degrees north or south the equator.
Explanation:
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Explanation:
Rutherford conducted an experiment in which he took a thin gold particle film on which he passes alpha- particles. He noticed that:
- Most of the alpha particles get through the film and can be detected by the detector.
- Around small portion of the alpha particle deflected at small angles.
- A very very few alpha particle (approximately 1 out of 1 million alpha particles) just retraced their path which means come back from the center.
He concluded that:
<u>Most of the space of the atom is empty and in the center of the atom , there is solid mass which is the cause of the alpha particles to come back. He gave the term nucleus to this solid mass.</u>
Answer:
is the smallest unit of ordinary matter that forms a chemical element.
Explanation:
and were created after the Big Bang 13.7 billion years ago.
