Answer:
HOFO = (0, 0, +1, -1)
Explanation:
The formal charge (FC) can be calculated using the following equation:

<u>Where:</u>
V: are the valence electrons
N: are the nonbonding electrons
B: are the bonding electrons
The arrange of the atoms in the oxyacid is:
H - O₁ - F - O₂
Hence, the formal charge (FC) on each of the atoms is:
H: FC = 1 - 0 - 1/2*(2) = 0
O₁: FC = 6 - 4 - 1/2*(4) = 0
F: FC = 7 - 4 - 1/2*(4) = +1
O₂: FC = 6 - 6 - 1/2*(2) = -1
We can see that the negative charge is in the oxygen instead of the most electronegative element, which is the F. This oxyacid is atypical.
I hope it helps you!
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Linking monomers together to form a polymer .This chemical reaction also forms water molecules.
<h3>What is Polymerization?</h3>
This is a type of reaction which involves the linking of two or more monomers to form a polymer.
Dehydration reaction forms water molecules as part of the product thereby making it the most appropriate choice.
Read more about Dehydration here brainly.com/question/1301665
#SPJ1
Answer: Pesticide and less than 6.65
Explanation:
E2020