Answer
Negative 5 and StartFraction 7 over 8 EndFractionfeet
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
Molecular are only between non-metals. Ionic has a higher melting point
Answer:
the chocolate
Explanation:
You are changing the amount of chocolate
Answer: The correct answer is (D).
Explanation:
Space photography help astronomers:
- To visualize and observe the position and appearance of celestial objects like: path of orbiting planets ,dim stars which invisible to naked eyes ,far away galaxies etc.
- To observe any phenomena which is occurring at macro level for example: collision of steroids and meteors etc.
