Answer:
0.0432M
Explanation:
We begin by writing a balanced equation for the reaction. This is illustrated below:
NaOH + HCl —> NaCl + H2O
From the equation above,
The number of mole of the acid (nA) = 1
The number of mole of the base (nB) = 1
Data obtained from the question include:
Vb (volume of the base) = 54mL
Cb (concentration of the base) = 0.1M
Va (volume of the acid) = 125mL
Ca ( concentration of the acid) =?
Using CaVa/CbVb = nA/nB, the concentration of the acid can easily be obtained as shown below:
CaVa/CbVb = nA/nB
Ca x 125 / 0.1 x 54 = 1
Cross multiply to express in linear form:
Ca x 125 = 0.1 x 54
Divide both side by 125
Ca = (0.1 x 54) / 125
Ca = 0.0432M
Therefore, the concentration of the acid is 0.0432M
<h2>Answer:</h2>
<h2>Explanations</h2>
The complete balanced equation for the given reaction is expressed as;
Given the following parameters
Mass of CH4 = 5.90×10^−3 g = 0.0059grams
Determine the moles of methane
According to stoichimetry, 1 mole of methane produces 2 moles of water, hence the moles of water required will be:
Determine the mass of water produced
Therefore the mass of water produced from the complete combustion of 5.90×10−3 g of methane is 1.33 * 10^-2grams
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
I am looking for this answer too. Did you ever find it? I could really use the help
Answer:
A) wrong. The molar is same so A is hevier
B)
Explanation:
Xg/mol × (same molar)= g
→ bigger molar bigger mass
