Answer:
<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u>
Explanation:
2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)
The equilibrium constant expression in terms of concentrations is:
Kc=<u>[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2</u><u>.</u>
<h2>Answer:</h2>
B) endothermic reaction.
<h2>Explanation:</h2>
Melting of ice is endothermic because it is taking heat from the environment, feeling cold, because it requires energy to break the ice bonds. It's also why you feel cold when wet it takes energy to evaporate water. The ice absorbs the energy from the environment. Its internal potential energy increases, therefore, it's endothermic. It also increases the entropy of reaction.
Answer: its a single replacement reaction
Groups IVB–VIII, IB, and IIB, or 4–12
Answer:
- <u><em>1.7 × 10³ kg of ore.</em></u>
Explanation:
Call X the amount of aluminum ore mined to produce 1.0 × 10³ kg the aluminum metal.
Then, taking into account the yield of the reaction (82 % = 0.82) and the percent of aluminun in the ore (71% = 0.71), you can write the following equation:
- X × 71% × 82% = 1.0 × 10³ kg
↑ ↑ ↑ ↑
(mass of ore) (% of Al in the ore) (yield) ( Al metal to obtain)
You must just simplify, solve and compute:
- X = 1,000 / (0.71 × 0.82) = 1,000 / 0.5822 = 1,717.6 Kg
Round to two significant figures; 1,700 kg = 1.7 × 10³ kg of ore ← answer.
