Answer:
C) tellurium (Te) is the correct answer.
First you need to balance the equation. Ba(OH)2+2HNO3=Ba(NO3)2+H2O. Then you can get the ratio of mole number of the reactants. The ratio is Ba(OH)2:HNO3=1:2. So the molarity of Ba(OH)2 is 38.5*0.85/2/20=0.82 molar.
Salt can dissolve in water because it is an ionic compound. The Na⁺ and Cl⁻ ions get solvated by the water molecules and leave the surface of the crystal;
The formula of ethanol is CH₃CH₂OH. Ethanol can dissolve in water because its OH group can form strong hydrogen bonds to the water molecules.
Answer:
Partial Pressure Of Water Vapor Is 18.65mmHg At 21C0. ... How many liters of H2 gas , collected over water at an atmospheric pressure of 752 mmHg and a temperture of 21 Co, can made from 3.566 g of Zn
Explanation:
B because it has a lower activation energy