Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Fold mountains<span> are </span>mountains<span> that form mainly by the effects of </span>folding<span> on layers within the upper part of the Earth's crust. Before either plate tectonic theory developed, or the internal architecture of thrust belts became well understood, the term was used for most</span>mountain<span> belts, such as the Himalayas.</span>
Answer: 300g
Explanation:
first we write the given values on top
224L. x
3 NO2 (g) + H2O (l) = 2HNO3 (l) + NO (g)
22.4L 30g
then we form a formula
224L/22.4L= x/30g
224*30/22.4
6720/22.4= 300g
Group 1 elements (usually called alkali metals) are not very electronegative and have small ionization energies due to that. The reason why they are not very electronegative is that they really want to loose their one valence electron so that they can have a noble gas electron configuration (completed octet).
I hope this helps.
Answer:
c sounds like the most reasonable answer rember to always divide the pressure value by 101
