Explanation:
1 mol = 22.4 l
5.42 mol = 22.4 × 5.42 = 121.408
in two decimal place it is 121.41
Answer:B
Explanation:According to the law of superposition, sedimentary and volcanic rock layers are deposited on top of each other. They harden over time to become a solidified (competent) rock column, that may be intruded by igneous rocks and disrupted by tectonic events.
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
There are 4 electron pairs (3 bonding and 1 lone pair) so the angle is 107 degrees. The 4 electron pairs are repelled to give a tetrahedral arrangement but the molecule has a pyrimidal shape due to the lone pair.
