C, erosion. Erosion is the natural process of breaking down natural products through wind, or similar natural resources.
2.25 I believe
Hope this helped!
STSN
Answer:
8.70 liters
Explanation:
First we <u>convert 36.12 g of AI₂O₃ into moles</u>, using its <em>molar mass</em>:
- 36.12 g ÷ 101.96 g/mol = 0.354 mol AI₂O₃
Then we <u>convert AI₂O₃ moles into O₂ moles</u>, using the stoichiometric coefficients of the reaction:
- 0.354 mol AI₂O₃ * = 0.531 mol O₂
We can now use the <em>PV=nRT equation</em> to <u>calculate the volume</u>, V:
- 1.4 atm * V = 0.531 mol * 0.082 atm·L·mol⁻¹·K⁻¹ * 280.0 K
It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs