<span>Which of the following are indicators of a chemical change? Select all that apply.
</span>
These are the answers:
<span>color change
temperature change
precipitate formation
gas formation
Hope this helps.
</span>
Answer:
B-Sucrose molecules are too large to conduct electricity in once dissolved in water.
D-Salts, like NaCL, have ionic bonds and are considered to be electrolytes:when dissolved in water, salts dissociate and form ions.
Explanation:
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
They help bring about chemical reactions. This is because enzymes act as catalysts, lowering the activation energy required for a chemical reaction to initiate. It is in this way that they bring about chemical reactions.
Answer:
powdered sugar
Explanation:
The higher is the exposed area of sugar, the faster is the dissolution process. Thus, to choose between the different types of sugar, we have to look at the volume occupied by the sugar.
In sugar cubes, the particles of sugar as compacted in a cube, so the particles inside the cube are not exposed to the solvent (water). So, sugar cubes have the slowest dissolution process. Then, in granulated sugar, the particles have more area exposed, so this type of sugar will dissolve faster than sugar cubes. Finally, powdered sugar is composed of tiny particles with more are exposed, so powdered sugar has the fastest dissolution process.
Therefore, powdered sugar will dissolve the fastest.
