<span>vibration of particles decreases as the temperature decreases It also decreases during phase change but temperature does not</span>
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
All matter is made up of substances called elements, which have specific chemical and physical properties and can't be broken down into other substances through ordinary chemical reactions. Gold, in this case, is an element so, therefore, it is considered matter.
Hope it helped :)
Answer:
the complete question is found in the attachment
Explanation:
the complete explanation is found in the attachment
Answer:
d. K<1 E∘cell is negative
Explanation:
Since E⁰ = negative , ΔG = -nFE⁰ = -nF -ve = +ve.
Also, ΔG = -RTlnK
K = exp(-RTΔG)
Since ΔG = +ve, -RTΔG = -ve
K = 1/exp(RTΔG) < 1.
So our answer is E⁰ cell is negative and K < 1
