Moles are the division of the mass and the molar mass. The moles of mercury (ii) oxide in the decomposition reaction needed to produce oxygen are 0.781 moles.
<h3>What is a decomposition reaction?</h3>
A decomposition reaction is a breakdown of the reactant into simpler products. The decomposition of mercury (ii) oxide can be shown as:
2HgO(s) → 2Hg(l) + O₂(g)
From the reaction, it can be said that 2 moles of mercury (ii) oxide decomposes to produce 1 mole of oxygen.
The moles of oxygen that needs to be produced are calculated as:
Moles = mass ÷ molar mass
= 12.5 gm ÷ 32 gm/mol
= 0.39 moles
0.39 moles of oxygen are needed to be produced.
From the stoichiometric coefficient of the reaction, the moles of HgO is calculated as: 2 × 0.39 = 0.781 moles
Therefore, 0.781 moles of HgO are required in the reaction.
Learn more about moles here:
brainly.com/question/3801333
#SPJ4
Answer:
Both
compounds in left hand side of the equation is called reactants.
compounds in right hand side of the equation is called products.
so ans is both water and carbon di oxide
Explanation:
2,3,5-trimethylhexane
C9H20
Molecular weight= 128.5g/mol
CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3
Answer:
M = 3.69 M.
Explanation:
Hello there!
In this case, according to the given information, it turns out possible for us to calculate the molar concentration of the 1.29 moles of KCl in 350 mL of solution by recalling the mathematical definition of molarity as the division of the moles by the volume in liters, in this case 0.350 L; thus, we proceed as follows:
Which gives molar units, M, or just mol/L.
Regards!
Density = mass / volume
19.3 = 13 / m
m = 13 / 19.3
m = 0.67g
