As the combustible materials burn, some of the chemical energy is transformed into heat energy, and some are transformed into light energy. Light energy, also known as radiation or electromagnetic energy, is a type of kinetic energy that takes the form of visible light waves, such as the light from a match.
<u>Answer:</u> The half life of the sample of silver-112 is 3.303 hours.
<u>Explanation:</u>
All radioactive decay processes undergoes first order reaction.
To calculate the rate constant for first order reaction, we use the integrated rate law equation for first order, which is:
![k=\frac{2.303}{t}\log \frac{[A_o]}{[A]}](https://tex.z-dn.net/?f=k%3D%5Cfrac%7B2.303%7D%7Bt%7D%5Clog%20%5Cfrac%7B%5BA_o%5D%7D%7B%5BA%5D%7D)
where,
k = rate constant = ?
t = time taken = 1.52 hrs
= Initial concentration of reactant = 100 g
[A] = Concentration of reactant left after time 't' = [100 - 27.3] = 72.7 g
Putting values in above equation, we get:

To calculate the half life period of first order reaction, we use the equation:

where,
= half life period of first order reaction = ?
k = rate constant = 
Putting values in above equation, we get:

Hence, the half life of the sample of silver-112 is 3.303 hours.
The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
In 1851 gold-seekers from around the world began pouring into the colonies, changing the course of Australian history. The gold rushes greatly expanded Australia's population, boosted its economy, and led to the emergence of a new national identity.
Explanation: