Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Answer: 1. Alcohol 2. Ester
Explanation:
Right on edge.
The genotype will be (tt)
Hope this helps!
2NH₂ + O₂ → N₂ + 2H₂O
<u>Explanation:</u>
Balancing the equation means, the number of atoms on both sides of the equation must be the same.
In the case of the given equation, we have to find out whether it is balanced or not.
2NH₂ + O₂ → N₂ + 2H₂O
Atoms Number of atoms before balancing after balancing
LHS RHS LHS RHS
N 1 2 2 2
H 2 2 4 4
O 2 1 2 2
To balance the N atoms, we have to put 2 in front of NH₂, and then to balance the H, O atoms, we have to put 2 in front of H₂O, so that each atom in left hand as well as right hand side of the equation was balanced.
To convert the given value to the desired one, use the proper unit conversions and dimensional analysis. Use the following conversion for the first set.
1 g = 100 cg
1 L = 1000 mL
Using the concept presented above,
V = (59800 cg/L)(1 g/100 cg)1 L/1000 mL)
V = 0.598 g/mL
