The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Radio active decay reactions follow first order rate kinetics.
a) The half life and decay constant for radio active decay reactions are related by the equation:
Where k is the decay constant
b) Finding out the decay constant for the decay of C-14 isotope:
c) Finding the age of the sample :
35 % of the radiocarbon is present currently.
The first order rate equation is,
![[A] = [A_{0}]e^{-kt}](https://tex.z-dn.net/?f=%20%5BA%5D%20%3D%20%5BA_%7B0%7D%5De%5E%7B-kt%7D%20%20%20)
![\frac{[A]}{[A_{0}]} = e^{-kt}](https://tex.z-dn.net/?f=%20%5Cfrac%7B%5BA%5D%7D%7B%5BA_%7B0%7D%5D%7D%20%3D%20e%5E%7B-kt%7D%20%20)
t = 7923 years
Therefore, age of the sample is 7923 years.
Answer:
the process in which energy is emitted by one object, transmitted through space, and absorbed by another
Explanation:
Radiation is energy that comes from a source and travels through space and may be able to penetrate various materials. Light, radio, and microwaves are
types of radiation that are called nonionizing.
Answer:
two negative charges is the answer of your question
The weighted average of the nail in accordance with the given data is 11.176g.
<h3>How to calculate weighted average?</h3>
Weighted average is an arithmetic mean of values biased according to agreed weightings.
The weighted average of the nail in the image above can be calculated by multiplying the decimal abundance with the mass of the nail, then summed up as follows;
Weighted average = (decimal abundance × mass 1) + (decimal abundance × mass 2)
Weighted average = (0.12 × 3.3) + (0.88 × 12.25)
Weighted average = 0.396 + 10.78
Weighted average = 11.176g
Therefore, 11.176g is the weighted average of the nail
Learn more about weighted average at: brainly.com/question/28042295
#SPJ1
