The condensed formula would be CH3-CH(CH4)-CH2-CH(CH4)-CH2-CH(CH4)-CH3. The molecular formula would be C10H25.
Answer:
it keeps the heat in and the bugs and flys out
Explanation:
Saturated solution is a solution in which no more solute can be dissolved in the solvent. When saturated solution cools, the solution began precipitate from the solution, because under lower temperature, usually, less amount solute can be dissolved in the solvent.
So there are basically five types of chemical reactions which have their general formulas.
They are:
1. Combination reaction
General formula : A+B = AB
2. Decomposition reaction
General formula: AB = A+B
3. Single displacement reaction
General formula: AB+C = CB + A
4. Double displacement reaction
General formula: AB+CD = CB+AD
5. Acid-base reaction
General formula: A+B = S+W
You should check and compare with examples.
