Answer:
Explanation:
1. Calculate the adult life
If the elephant is an adult from its 10th birthday until the day before its 56th birthday, its
Adult life = 55 - 10 + 1 = 46 yr
2. Convert years to days
3. Convert days to pounds of feed
4. Convert pounds to kilograms and megagrams
Note: The answer can have only two significant figures because that is all you gave for age of the elephant.
Answer:
pH = 4.543
Explanation:
- CH3CH2COOH + H2O ↔ CH3CH2COO- + H3O+
- pKa = - Log Ka
∴ Ka = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
∴ pKa = 4.87
⇒ Ka = 1.349 E-5 = [H3O+][CH3CH2COO-]/[CH3CH2COOH]
added 300 mL 0f 0.02 M NaOH:
⇒ <em>C</em> CH3CH2COOH = ((0.200 L)(0.15 M)) - ((0.300 L)(0.02 M))/(0.3 + 0.2)
⇒ <em>C</em> CH3CH2COOH = 0.048 M
⇒ <em>C</em> NaOH = (0.300 L)(0.02 M) / (0.3 +0.2) = 0.012 M
mass balance:
⇒ 0.048 + 0.012 = 0.06 M = [CH3CH2COO-] + [CH3CH2COOH].......(1)
charge balance:
⇒ [H3O+] + [Na+] = [CH3CH2COO-]
∴ [Na+] = 0.02 M
⇒ [CH3CH2COO-] = [H3O+] + 0.02 M.............(2)
(2) in (1):
⇒ [CH3CH2COOH] = 0.06 M - 0.02 M - [H3O+] = 0.04 M - [H3O+]
replacing in Ka:
⇒ 1.349 E-5 = [H3O+][([H3O+] + 0.02) / (0.04 - [H3O+])
⇒ (1.349 E-5)(0.04 - [H3O+]) = [H3O+]² + 0.02[H3O+]
⇒ 5.396 E-7 - 1.349 E-5[H3O+] = [H3O+]² + 0.02[H3O+]
⇒ [H3O+]² + 0.02001[H3O+] - 5.396 E-7 = 0
⇒ [H3O+ ] = 2.867 E-5 M
∴ pH = - Log [H3O+]
⇒ pH = 4.543
Tsunamis are the largest waves in the world. The edges of the plates, where earthquakes and volcanoes often occur, usually lie near the edges of the oceans
Answer is: 4,4 grams <span>of carbon dioxide gas would be produced.
</span>Chemical reaction: CaCO₃ + 2HCl → CaCl₂ + CO₂ + H₂O.
m(CaCO₃) = 10 g.
n(CaCO₃) = 10 g ÷ 100 g/mol.
n(CaCO₃) = 0,1 mol.
From chemical reaction: n(CaCO₃) : n(CO₂) = 1 : 1.
n(CO₂) = 0,1 mol.
m(CO₂) = n(CO₂) · M(CO₂).
m(CO₂) = 0,1 mol· 44 g/mol.
m(CO₂) = 4,4 g.
