Answer:
1.76
Explanation:
There is some info missing. I think this is the original question.
<em>A chemist dissolves 660.mg of pure hydroiodic acid in enough water to make up 300.mL of solution. Calculate the pH of the solution. Be sure your answer has the correct number of significant digits.</em>
<em />
Step 1: Calculate the molarity of HI(aq)
M = mass of solute / molar mass of solute × liters of solution
M = 0.660 g / 127.91 g/mol × 0.300 L
M = 0.0172 M
Step 2: Write the acid dissociation reaction
HI(aq) ⇄ H⁺(aq) + I⁻(aq)
HI is a strong acid, so [H⁺] = 0.0172 M
Step 3: Calculate the pH
pH = -log [H⁺]
pH = -log 0.0172
pH = 1.76
Answer:Iron(|||) Hydroxide
Explanation:Fe is iron and OH is hydroxide
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Volume fraction = volume of the element / volume of the alloy
Volume = density * mass
Base: 100 grams of alloy
mass of tin = 15 grams
mass of lead = 85 grams
volume = mass / density
Volume of tin = 15g / 7.29 g/cm^3 = 2.06 cm^3
Volume of lead = 85 g / 11.27 g/cm^3 = 7.54 cm^3
Volume fraction of tin = 2.06 cm^3 / (2.06 cm^3 + 7.54 cm^3) = 0.215
Volume fraction of lead = 7.54 cm^3 / (2.06 cm^3 + 7.54 cm^3) = 0.785
As you can verify the sum of the two volume fractions equals 1: 0.215 + 0.785 = 1.000
