IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH
1 answer:
You might be interested in
Answer:
0.159 M
Explanation:
convert from mL to L then use the equation:
M1V1 = M2V2
rearrange to find M2
Answer : The moles of are, 2.125 mole.
Explanation : Given,
Molarity of = 8.500 M
Volume of solution = 250 mL = 0.250 L (1 L = 1000 mL)
Molarity : It is defined as the number of moles of solute present in one liter of volume of solution.
Formula used :
Now put all the given values in this formula, we get:
Therefore, the moles of are, 2.125 mole.
The integrated rate law for a second-order reaction is given by:
where, [A]t= the concentration of A at time t,
[A]0= the concentration of A at time t=0
<span>k =</span> the rate constant for the reaction
<u>Given</u>: [A]0= 4 M, k = 0.0265 m–1min–1 and t = 180.0 min
Hence,
<span> = 4.858</span>
<span><span><span>Therefore, [A]</span>t</span>= 0.2058 M.</span>
<span>
</span>
<span>Answer: C</span>oncentration of A, after 180 min, is 0.2058 M