Answer:
bacteria
Explanation:
The pathogen below is a single-celled organism without a nucleus that can cause illness in a humans.
The state of matter with the slowest moving atoms is solid!
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Answer:
Yes. The two elements can combine to form different compounds.
Explanation:
Two elements can combine at different ratios.
Consider CO and CO₂. Both are made from carbon and oxygen. However, C and O combine at a 1:1 ratio in CO but at a 1:2 ratio in CO₂. CO is a fuel; it burns in the air. CO₂ does not burn in the air; it is used to put out fires and is found in extinguishers. CO and CO₂ are two distinct compounds.
There are many ways for the elements to combine with each other. As a result, the first twenty elements on the periodic table alone can produce a large number of compounds.
