It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs
To form a salt compound, the acid contribute a NON METAL ION and the base contributes a METAL ION.
In chemistry, acid and base react together to form salt and water only. For the salt formed, the positive metal ion comes from the base while the negative non metal ion comes from the acid.
Answer:When table salt is added to water the resulting solution has a higher boiling point than the water did by itself. The ions form an attraction with the solvent particles that then prevent the water molecules from going into the gas phase. Therefore, the salt-water solution will not boil at 100oC.Jun
Explanation:
1) Balanced equation
C3H8 + 5O2 -> 3 CO2 + 4 H2O
2) 0.700 L C3H8
Given the pressure and temperature do not change, the molar ratio is equivalent to volume ratio
1molC3H8 / 5 mol O2 => 1 L C3H8 / 5 L O2
0.700 L C3H8 / x L O2 = 1 L C3H8 / 5 L O2 => x = 0.700 L C3H8 * 5 L O2 / 1 L C3H8
x = 3.500 L O2
3) CO2 produced
1 L C3H8 / 3 L CO2 = 0.700 L C3H8 / x L CO2 =>
x = 0.700 L C3H8 * 3 L CO2 / 1 L C3H8 = 2.100 L CO2
4) Water vapor produced
1) 1 L C3H8 / 4 L H2O = 0.700 LC3H8 / x L H2O =>
x = 0.700 L C3H8 * 4 L H20 / 1 L C3H8 = 2.800 L H2O
