Answer:
Water pressure 0.5 atm
Total Pressure= 2.27 atm
Explanation:
To answer this problem, one has to realize that there are two processes that increase the temperature of the sealed vessel.
First, the dry air in the sealed vessel will be heated which will cause its pressure to increase and it can be determined by the equation:
P₁ x T₂ = P₂ x T₁ ∴ P₂ = P₁ x T₂ / T₁
For the second process, we have an amount of n moles of water which will be released when the copper sulfate is heated. In this case, to determine the value of the the water gas we will use the gas law:
PV = nRT ∴ P = nRT/V
n will we calculated from the quantity of sample.
2.50 g CuSo₄ 5H₂O x 1 mol/ 249.69 g = 0.01 mol CuSo₄ 5H₂O
the amount water of hydration is
= 0.01 mol CuSo₄ 5H₂O * 5 mol H₂O / 1 mol CuSo₄ 5H₂O
= 0.05 mo H₂O
pressure of dry air at the final temperature,
P₂ = 1 atm x 500 K/ 300 K = 1.67 atm
Pressure of water :
P (H₂O) 0.05 mol x 0.08206 Latm/kmol x 500 K/ 4 L = 0.5 atm
∴ Total Pressure = 1.67 atm
H2O Pressure = 0.5 atm
Answer: The product from the reduction reaction is
CH3-CH2-CH(CH3)-CH2-CH2OH
IUPAC name; 3- Methylpentan-1-ol
Explanation:
Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.
Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal
CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;
3-methylpenta-1-ol .
The structure of the product is:
CH3-CH2-CH(CH3)-CH2-CH2OH
Group 6 elements usually have extra electrons to make give them an octet. So, they have 6 electrons to start and when they have an octet, they have 8.
We can find the charge by doing simple math 6 - 8 = -2
Answer is D)
KCl and PbCl2 both are salts having the same white color, however, potassium salts are soluble in water while lead salts are not.
This means that KCl is soluble in water while PbCl2 is not.
So, to distinguish between them, add the same amount of each salt in a beakers containing water (each salt in a separate beaker of course), ans shake the beaker or steer it.
The salt that dissolves in water would be KCl while the salt that doesn't dissolve in water would be PbCl2.
