All categories

3 years ago

Sin100cos40-cos100sin40

Physics

1 answer:

Andre45 [30]3 years ago

6 0

Answer:

Sin(60°)= $\frac{\sqrt{3} }{2}$

Explanation:

Assuming the given angles are in degrees

We know that Sin(A-B)=SinACosB-CosASinB

Here A=100° and B=40°

$Sin(100)Cos(40)-Cos(100)Sin(40)=Sin(100-40)=Sin(60)=\frac{\sqrt{3} }{2}$

You might be interested in

A pulley lifts a 72-N load with a force of 24-N. The input distance is 2m and the output distance is 0.5m. What is the efficienc

Debora [2.8K]

Answer:

Explanation:

Work done on the lever ( input energy ) = force applied x input distance

= 24 N x 2m = 48 J

Work done by the lever ( output energy ) = load x output distance

= 72 N x 0.5m = 36 J

efficiency = output energy / input energy

= 36 J / 48 J

= 3 / 4 = .75

In percentage terms efficiency = 75 % .

5 0

3 years ago

A formula for the normal systolic blood pressure for a man age a , measured in mmhg, is given as p=0. 006a2−0. 02a 120. Find the

djyliett [7]

The age of a man whose normal blood pressure measures 123 mm of hg

9 years

<h3>What is Quadratic equation ?</h3>

A quadratic equation as an equation of degree 2, meaning that the highest exponent of this function is 2. The standard form of a quadratic equation is y = a $x^{2}$ + bx + c, where a, b, and c are numbers and a cannot be 0

P(A) = 0.006 $a^{2}$ - 0.02a + 120

123 = 0.006- 0.02a + 120

0=0.006 $a^{2}$ - 0.02a - 3

you can use the quadratic equation formula to solve for the man's age.

A = (-b ± ( $\sqrt{b^{2} - 4*a*c}$ ) ) / (2a)

A = (0.02 ± $\sqrt{(-0.02)^{2} - 4*0.006*(-3)}$ / (2*0.006)

A = (0.02 ± $\sqrt{0.0076}$ ) / 0.012

A = 9 , -5.67

Age of the man will be 9 years

To learn more about quadratic equation here

brainly.com/question/17177510?referrer=searchResults

#SPJ4

5 0

2 years ago

How does an increase in greenhouse gases in the atmosphere cause an increase in global temperature?

daser333 [38]

Answer:

<h2>Greenhouse gases absorb and emit radiation and less heat dissipates to space</h2>

Explanation:

when heat is trapped it is conducted to the trapped area and gradually heats up its surrounding

8 0

3 years ago

The car's initial speed was 15 m / s and the distance the car travels before it comes to a complete stop after the driver applie

pentagon [3]

Initial speed of the car (u) = 15 m/s

Final speed of the car (v) = 0 m/s (Car comes to a complete stop after driver applies the brake)

Distance travelled by the car before it comes to halt (s) = 63 m

By using equation of motion, we get:

$\bf \longrightarrow {v}^{2} = {u}^{2} + 2as \\ \\ \rm \longrightarrow {0}^{2} = {15}^{2} + 2 \times a \times 63 \\ \\ \rm \longrightarrow 0 = 225 + 126a \\ \\ \rm \longrightarrow 126a = - 225 \\ \\ \rm \longrightarrow a = - \dfrac{225}{126} \\ \\ \rm \longrightarrow a = - 1.78 \: m {s}^{ - 2}$

$\therefore$ Acceleration of the car (a) = -1.78 m/s²

Magnitude of the car's acceleration (|a|) = 1.78 m/s²

5 0

3 years ago

A machine is classified as a compound machine when ___.

bearhunter [10]

Answer: it is made up two or more simple machines

Explanation: Brainliest Please!!!!

6 0

2 years ago

Sin100cos40-cos100sin40​

Sin100cos40-cos100sin40