All categories

3 years ago

_____ occurs when the product of the ion concentrations exceeds the Ksp.

Chemistry

2 answers:

arlik [135]3 years ago

4 0

Precipitation occurs when the product of the ion concentration exceeds the Ksp.

serious [3.7K]3 years ago

4 0

Answer : Precipitation occurs when the product of the ion concentrations exceeds the $K__{sp}$ .

Explanation :

Ionic product : It is the product of the concentrations of the ions in solution raised to the same power by its stoichiometric coefficient in a solution of a salt. This takes place at any concentration. The ionic product is represented as, Q.

Solubility product constant : It is defined as the product of the concentration of the ions present in a solution raised to the power by its stoichiometric coefficient in a solution of a salt. This takes place at equilibrium only. The solubility product constant is represented as, $K__{sp}$ .

There are three cases for the solubility :

When $Q$ this means that the solution is unsaturated solution and more solid will be dissolve.
When $Q=k_{sp}$ this means that the solution is saturated solution.
When $Q>k_{sp}$ this means that the solution is supersaturated solution and solid will be precipitate.

Hence, the precipitation occurs when the product of the ion concentrations exceeds the $K__{sp}$ .

You might be interested in

What happens to the atomic radius when an electron is gained?

LenaWriter [7]

A. The negative ionic radius is larger than the neutral atomic radius.

6 0

2 years ago

A volume of 80.0 mL of H2O is initially at room temperature (22.00 ∘C). A chilled steel rod at 2.00 ∘C is placed in the water. I

murzikaleks [220]

Answer:

The mass of the steel bar is 26.833 grams

Explanation:

Step 1: data given

ΣQ gained = ΣQ lost

Q=m*C*ΔT

with m = mass in grams

with C= specific heat capacity ( in J/(g°C))

with ΔT = change in temperature = T2-T1

Qsteel = Qwater

msteel * Csteel * (T2steel - T1steel) = mwater * Cwater * (T2water - T1water)

Mass of steel = TO BE DETERMINED

mass of water =⇒ since 1mL = 1g : 80 mL = 80g

Csteel =0.452 J/(g °C

Cwater = 4.18 J/(g °C

initial temperature steel T1 : 2 °C

final temperature steel T2 = 21.3 °C

initial temperature water T1 =22 °C

final temperature water T2 = 21.3 °C

Step 2: Calculate mass of steel

msteel * Csteel * (T2steel - T1steel) = mwater * Cwater * (T2water - T1water)

msteel * 0.452 *(21.3-2) = 80 * 4.18 * (21.3-22)

msteel = (80 * 4.18 * (-0.7)) / (0.452 * 19.3)

msteel = -234.08 / 8.7236

msteel = -26.833 g

Since mass can't be negative we should take the absolute value of it = 26.833g

The mass of the steel bar is 26.833 grams

6 0

3 years ago

How am I ment to label this diagram

lora16 [44]

I believe you have to label out the positive metal ion and the delocalized electrons. They're the 2 things that makes up a metal structure.

In the diagram, the circles with the + symbol are the positive metal ions, since + represents positive. And the remaining - circles are the delocalized electrons, as electrons are negative.

And for how a metal conducts electricity, since they're delocalized mobile electrons present in any metal structures, they're able to move away from the metal to the positive side of the battery and more electrons can replace their place flowing from the negative side.

5 0

3 years ago

Potassium (k combines with magnesium bromide (mgbr2 to form potassium bromide (kbr and magnesium (mg during a single replacement

Agata [3.3K]

In balancing reactions, the number of atoms on each side should be of equal number. It is the most important rule in reactions. Also, we should know the correct substances involved in the reaction. We do as follows:

2K + MgBr2 = 2KBr + Mg

5 0

3 years ago

Read 2 more answers

Write the equilibrium expression of each chemical equation. 2H2S(g) 2H2(g) + S2(g)

hodyreva [135]

Answer:

[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2

Explanation:

2H2S(g)⇋2H2(g)+S2(g)2H2S(g)⇋2H2(g)+S2(g)

The equilibrium constant expression in terms of concentrations is:

Kc=[H2]2[S2][H2S]2Kc=[H2]2[S2][H2S]2.

6 0

2 years ago